C22H19ClN4O3S2 — CID 55561000
3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)benzamide (PubChem CID 55561000) has the molecular formula C22H19ClN4O3S2 and a molecular weight of 487.01 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)benzamide.
| Compound Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55561000 |
| Molecular Formula | C22H19ClN4O3S2 |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.06 |
| IUPAC Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(imidazo[2,1-b][1,3]thiazol-6-ylmethyl)benzamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)NCc2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C22H19ClN4O3S2/c1-2-10-27(20-9-4-3-8-19(20)23)32(29,30)18-7-5-6-16(13-18)21(28)24-14-17-15-26-11-12-31-22(26)25-17/h2-9,11-13,15H,1,10,14H2,(H,24,28) |
| InChIKey | OVZVZRWCJBAUKT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|