C22H20Cl2N2O3S2 — CID 39735531
3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylbenzamide (PubChem CID 39735531) has the molecular formula C22H20Cl2N2O3S2 and a molecular weight of 495.45 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylbenzamide.
| Compound Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 39735531 |
| Molecular Formula | C22H20Cl2N2O3S2 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-[(5-chlorothiophen-2-yl)methyl]-N-methylbenzamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)N(C)Cc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C22H20Cl2N2O3S2/c1-3-13-26(20-10-5-4-9-19(20)23)31(28,29)18-8-6-7-16(14-18)22(27)25(2)15-17-11-12-21(24)30-17/h3-12,14H,1,13,15H2,2H3 |
| InChIKey | XWGSYPNGMNEGIS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|