C16H17ClN2O3S2 — CID 39735471
N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 39735471) has the molecular formula C16H17ClN2O3S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 39735471 |
| Molecular Formula | C16H17ClN2O3S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N-methyl-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N(C)Cc2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C16H17ClN2O3S2/c1-3-9-18-24(21,22)14-6-4-5-12(10-14)16(20)19(2)11-13-7-8-15(17)23-13/h3-8,10,18H,1,9,11H2,2H3 |
| InChIKey | RDRJOKROKOEXOS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|