C19H22N2O3S2 — CID 24545003
N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 24545003) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24545003 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-methyl-N-[(4-methylsulfanylphenyl)methyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N(C)Cc2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-4-12-20-26(23,24)18-7-5-6-16(13-18)19(22)21(2)14-15-8-10-17(25-3)11-9-15/h4-11,13,20H,1,12,14H2,2-3H3 |
| InChIKey | STBKZPUZGOPAKU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|