C23H23ClN2O3S — CID 71910625
3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(cyclopropylmethyl)-N-prop-2-ynylbenzamide (PubChem CID 71910625) has the molecular formula C23H23ClN2O3S and a molecular weight of 442.97 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(cyclopropylmethyl)-N-prop-2-ynylbenzamide.
| Compound Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(cyclopropylmethyl)-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 71910625 |
| Molecular Formula | C23H23ClN2O3S |
| Molecular Weight | 442.97 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]-N-(cyclopropylmethyl)-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(CC1CC1)C(=O)c1cccc(S(=O)(=O)N(CC=C)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H23ClN2O3S/c1-3-14-25(17-18-12-13-18)23(27)19-8-7-9-20(16-19)30(28,29)26(15-4-2)22-11-6-5-10-21(22)24/h1,4-11,16,18H,2,12-15,17H2 |
| InChIKey | AWHKDVJGSYMEML-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.97 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|