C25H29ClN2O5S — CID 26888500
[2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 26888500) has the molecular formula C25H29ClN2O5S and a molecular weight of 505.04 g/mol. Its IUPAC name is [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 26888500 |
| Molecular Formula | C25H29ClN2O5S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | [2-[(3S,5S)-3,5-dimethylpiperidin-1-yl]-2-oxoethyl] 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)OCC(=O)N2C[C@@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C25H29ClN2O5S/c1-4-12-28(23-11-6-5-10-22(23)26)34(31,32)21-9-7-8-20(14-21)25(30)33-17-24(29)27-15-18(2)13-19(3)16-27/h4-11,14,18-19H,1,12-13,15-17H2,2-3H3/t18-,19-/m0/s1 |
| InChIKey | HXSUHHADHSACNJ-OALUTQOASA-N |
| XLogP | 4.38 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|