C23H17ClN2O4S — CID 2409931
(4-cyanophenyl) 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 2409931) has the molecular formula C23H17ClN2O4S and a molecular weight of 452.92 g/mol. Its IUPAC name is (4-cyanophenyl) 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | (4-cyanophenyl) 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2409931 |
| Molecular Formula | C23H17ClN2O4S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | (4-cyanophenyl) 3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)Oc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C23H17ClN2O4S/c1-2-14-26(22-9-4-3-8-21(22)24)31(28,29)20-7-5-6-18(15-20)23(27)30-19-12-10-17(16-25)11-13-19/h2-13,15H,1,14H2 |
| InChIKey | ZXTBZHWZAUFOBN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|