C25H25ClN4O3S — CID 112844113
N-(1-tert-butyl-4-cyanopyrrol-2-yl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide (PubChem CID 112844113) has the molecular formula C25H25ClN4O3S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-(1-tert-butyl-4-cyanopyrrol-2-yl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide.
| Compound Name | N-(1-tert-butyl-4-cyanopyrrol-2-yl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 112844113 |
| Molecular Formula | C25H25ClN4O3S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | N-(1-tert-butyl-4-cyanopyrrol-2-yl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)Nc2cc(C#N)cn2C(C)(C)C)c1 |
| InChI | InChI=1S/C25H25ClN4O3S/c1-5-13-30(22-12-7-6-11-21(22)26)34(32,33)20-10-8-9-19(15-20)24(31)28-23-14-18(16-27)17-29(23)25(2,3)4/h5-12,14-15,17H,1,13H2,2-4H3,(H,28,31) |
| InChIKey | PJDPVEDRLBJGNU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|