C23H20ClNO7S — CID 35836079
methyl 5-[[3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate (PubChem CID 35836079) has the molecular formula C23H20ClNO7S and a molecular weight of 489.93 g/mol. Its IUPAC name is methyl 5-[[3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 35836079 |
| Molecular Formula | C23H20ClNO7S |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | methyl 5-[[3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoyl]oxymethyl]furan-2-carboxylate |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)OCc2ccc(C(=O)OC)o2)c1 |
| InChI | InChI=1S/C23H20ClNO7S/c1-3-13-25(20-10-5-4-9-19(20)24)33(28,29)18-8-6-7-16(14-18)22(26)31-15-17-11-12-21(32-17)23(27)30-2/h3-12,14H,1,13,15H2,2H3 |
| InChIKey | OJMNWAQOABVQRB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|