C22H16Cl3NO4S — CID 2667252
(4-chlorophenyl) 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate (PubChem CID 2667252) has the molecular formula C22H16Cl3NO4S and a molecular weight of 496.80 g/mol. Its IUPAC name is (4-chlorophenyl) 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate.
| Compound Name | (4-chlorophenyl) 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 2667252 |
| Molecular Formula | C22H16Cl3NO4S |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | (4-chlorophenyl) 4-chloro-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzoate |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cc(C(=O)Oc2ccc(Cl)cc2)ccc1Cl |
| InChI | InChI=1S/C22H16Cl3NO4S/c1-2-13-26(20-6-4-3-5-18(20)24)31(28,29)21-14-15(7-12-19(21)25)22(27)30-17-10-8-16(23)9-11-17/h2-12,14H,1,13H2 |
| InChIKey | DIDNNSAXPGVTGI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|