C16H15Cl2NO3S — CID 100507319
2,5-dichloro-N-(2-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide (PubChem CID 100507319) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 100507319 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 2,5-dichloro-N-(2-methoxyphenyl)-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(c1ccccc1OC)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H15Cl2NO3S/c1-3-10-19(14-6-4-5-7-15(14)22-2)23(20,21)16-11-12(17)8-9-13(16)18/h3-9,11H,1,10H2,2H3 |
| InChIKey | BJCQIKPSQOTDRR-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|