C16H14Cl3NO5S — CID 50894812
2-(N-(2,5-dichlorophenyl)sulfonyl-2,5-dimethoxyanilino)acetyl chloride (PubChem CID 50894812) has the molecular formula C16H14Cl3NO5S and a molecular weight of 438.72 g/mol. Its IUPAC name is 2-(N-(2,5-dichlorophenyl)sulfonyl-2,5-dimethoxyanilino)acetyl chloride.
| Compound Name | 2-(N-(2,5-dichlorophenyl)sulfonyl-2,5-dimethoxyanilino)acetyl chloride |
|---|---|
| PubChem CID | 50894812 |
| Molecular Formula | C16H14Cl3NO5S |
| Molecular Weight | 438.72 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 2-(N-(2,5-dichlorophenyl)sulfonyl-2,5-dimethoxyanilino)acetyl chloride |
| SMILES | COc1ccc(OC)c(N(CC(=O)Cl)S(=O)(=O)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl3NO5S/c1-24-11-4-6-14(25-2)13(8-11)20(9-16(19)21)26(22,23)15-7-10(17)3-5-12(15)18/h3-8H,9H2,1-2H3 |
| InChIKey | BMVQFCYHMGXEHV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.72 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|