C15H14Cl2N4O6S — CID 50893773
2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide (PubChem CID 50893773) has the molecular formula C15H14Cl2N4O6S and a molecular weight of 449.27 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50893773 |
| Molecular Formula | C15H14Cl2N4O6S |
| Molecular Weight | 449.27 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | 2,5-dichloro-N-(2-hydrazinyl-2-oxoethyl)-N-(2-methoxy-5-nitrophenyl)benzenesulfonamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)NN)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H14Cl2N4O6S/c1-27-13-5-3-10(21(23)24)7-12(13)20(8-15(22)19-18)28(25,26)14-6-9(16)2-4-11(14)17/h2-7H,8,18H2,1H3,(H,19,22) |
| InChIKey | VANHHOIGOQEWHK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 144.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|