C22H18Cl2N4O6S — CID 126191320
2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 126191320) has the molecular formula C22H18Cl2N4O6S and a molecular weight of 537.38 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126191320 |
| Molecular Formula | C22H18Cl2N4O6S |
| Molecular Weight | 537.38 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]-N-[(Z)-(2-chloro-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)N/N=C\c1cc([N+](=O)[O-])ccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl2N4O6S/c1-34-21-10-7-16(23)12-20(21)27(35(32,33)18-5-3-2-4-6-18)14-22(29)26-25-13-15-11-17(28(30)31)8-9-19(15)24/h2-13H,14H2,1H3,(H,26,29)/b25-13- |
| InChIKey | RBVNDUGINWIJJW-MXAYSNPKSA-N |
| XLogP | 4.26 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|