C17H16Cl2N4O6S — CID 4679421
2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(2-chloro-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 4679421) has the molecular formula C17H16Cl2N4O6S and a molecular weight of 475.31 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(2-chloro-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(2-chloro-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4679421 |
| Molecular Formula | C17H16Cl2N4O6S |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(2-chloro-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)NN=Cc2cc([N+](=O)[O-])ccc2Cl)cc1Cl |
| InChI | InChI=1S/C17H16Cl2N4O6S/c1-22(30(27,28)13-4-6-16(29-2)15(19)8-13)10-17(24)21-20-9-11-7-12(23(25)26)3-5-14(11)18/h3-9H,10H2,1-2H3,(H,21,24) |
| InChIKey | OXWGYRFXFKQJQL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|