C18H20ClN3O4S2 — CID 6037281
2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide (PubChem CID 6037281) has the molecular formula C18H20ClN3O4S2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6037281 |
| Molecular Formula | C18H20ClN3O4S2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(4-methylsulfanylphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)N/N=C\c2ccc(SC)cc2)cc1Cl |
| InChI | InChI=1S/C18H20ClN3O4S2/c1-22(28(24,25)15-8-9-17(26-2)16(19)10-15)12-18(23)21-20-11-13-4-6-14(27-3)7-5-13/h4-11H,12H2,1-3H3,(H,21,23)/b20-11- |
| InChIKey | NLQKGLFPBKRVPQ-JAIQZWGSSA-N |
| XLogP | 2.84 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|