C18H20ClN3O5S — CID 92511381
N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 92511381) has the molecular formula C18H20ClN3O5S and a molecular weight of 425.89 g/mol. Its IUPAC name is N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 92511381 |
| Molecular Formula | C18H20ClN3O5S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)N/N=C\c2ccccc2Cl)cc1OC |
| InChI | InChI=1S/C18H20ClN3O5S/c1-22(12-18(23)21-20-11-13-6-4-5-7-15(13)19)28(24,25)14-8-9-16(26-2)17(10-14)27-3/h4-11H,12H2,1-3H3,(H,21,23)/b20-11- |
| InChIKey | BRQJXAPADGIECY-JAIQZWGSSA-N |
| XLogP | 2.13 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|