C20H25N3O6S — CID 92519550
2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(2-ethoxyphenyl)methylideneamino]acetamide (PubChem CID 92519550) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(2-ethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(2-ethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92519550 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(2-ethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccccc1/C=N\NC(=O)CN(C)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O6S/c1-5-29-17-9-7-6-8-15(17)13-21-22-20(24)14-23(2)30(25,26)16-10-11-18(27-3)19(12-16)28-4/h6-13H,5,14H2,1-4H3,(H,22,24)/b21-13- |
| InChIKey | HSPUFVBXXJTPQH-BKUYFWCQSA-N |
| XLogP | 1.87 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|