C27H31N3O7S — CID 126140931
N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide (PubChem CID 126140931) has the molecular formula C27H31N3O7S and a molecular weight of 541.63 g/mol. Its IUPAC name is N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126140931 |
| Molecular Formula | C27H31N3O7S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-[(Z)-(3,4-diethoxyphenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C27H31N3O7S/c1-5-36-24-14-12-20(16-26(24)37-6-2)18-28-29-27(31)19-30(21-10-8-7-9-11-21)38(32,33)22-13-15-23(34-3)25(17-22)35-4/h7-18H,5-6,19H2,1-4H3,(H,29,31)/b28-18- |
| InChIKey | SONLDJJVLWNARP-VEILYXNESA-N |
| XLogP | 3.85 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|