C28H33N3O6S — CID 43880953
2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 43880953) has the molecular formula C28H33N3O6S and a molecular weight of 539.65 g/mol. Its IUPAC name is 2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 43880953 |
| Molecular Formula | C28H33N3O6S |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | 2-(N-(4-ethoxyphenyl)sulfonylanilino)-N-[(E)-(3-ethoxy-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1ccc(/C=N/NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccc(OCC)cc2)cc1OCC |
| InChI | InChI=1S/C28H33N3O6S/c1-4-18-37-26-17-12-22(19-27(26)36-6-3)20-29-30-28(32)21-31(23-10-8-7-9-11-23)38(33,34)25-15-13-24(14-16-25)35-5-2/h7-17,19-20H,4-6,18,21H2,1-3H3,(H,30,32)/b29-20+ |
| InChIKey | DHIUGTICRWOZTR-ZTKZIYFRSA-N |
| XLogP | 4.62 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|