C28H33N3O5S — CID 6277911
2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide (PubChem CID 6277911) has the molecular formula C28H33N3O5S and a molecular weight of 523.66 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6277911 |
| Molecular Formula | C28H33N3O5S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-propan-2-ylanilino]-N-[(Z)-(3-methoxy-4-propoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)CN(c2ccc(C(C)C)cc2)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C28H33N3O5S/c1-5-17-36-26-16-11-22(18-27(26)35-4)19-29-30-28(32)20-31(24-14-12-23(13-15-24)21(2)3)37(33,34)25-9-7-6-8-10-25/h6-16,18-19,21H,5,17,20H2,1-4H3,(H,30,32)/b29-19- |
| InChIKey | AZMBYAFDEWOXER-CEUNXORHSA-N |
| XLogP | 4.95 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|