C30H27Cl2N3O5S — CID 126033715
N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide (PubChem CID 126033715) has the molecular formula C30H27Cl2N3O5S and a molecular weight of 612.54 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126033715 |
| Molecular Formula | C30H27Cl2N3O5S |
| Molecular Weight | 612.54 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccc(Cl)cc2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C30H27Cl2N3O5S/c1-2-39-29-18-22(11-16-28(29)40-21-23-7-6-8-25(32)17-23)19-33-34-30(36)20-35(26-9-4-3-5-10-26)41(37,38)27-14-12-24(31)13-15-27/h3-19H,2,20-21H2,1H3,(H,34,36)/b33-19- |
| InChIKey | BNVWPLQMVJVZGK-APTWKGOFSA-N |
| XLogP | 6.32 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.54 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|