C26H25Cl2N3O5S — CID 126030266
2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 126030266) has the molecular formula C26H25Cl2N3O5S and a molecular weight of 562.48 g/mol. Its IUPAC name is 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126030266 |
| Molecular Formula | C26H25Cl2N3O5S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 2-(3-chloro-N-(4-chlorophenyl)sulfonylanilino)-N-[(Z)-(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1ccc(/C=N\NC(=O)CN(c2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)cc1OCC |
| InChI | InChI=1S/C26H25Cl2N3O5S/c1-3-14-36-24-13-8-19(15-25(24)35-4-2)17-29-30-26(32)18-31(22-7-5-6-21(28)16-22)37(33,34)23-11-9-20(27)10-12-23/h3,5-13,15-17H,1,4,14,18H2,2H3,(H,30,32)/b29-17- |
| InChIKey | BXJNIJGYNWUGAV-RHANQZHGSA-N |
| XLogP | 5.30 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|