C29H33N3O5S — CID 4111677
2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide (PubChem CID 4111677) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4111677 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)-N-[(3-ethoxy-4-prop-2-enoxyphenyl)methylideneamino]acetamide |
| SMILES | C=CCOc1ccc(C=NNC(=O)CN(c2cc(C)ccc2C)S(=O)(=O)c2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C29H33N3O5S/c1-6-16-37-27-15-12-24(18-28(27)36-7-2)19-30-31-29(33)20-32(26-17-22(4)8-11-23(26)5)38(34,35)25-13-9-21(3)10-14-25/h6,8-15,17-19H,1,7,16,20H2,2-5H3,(H,31,33) |
| InChIKey | HNQZTWYQOYUBOI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|