C18H21N3O5S — CID 25162948
2-[benzenesulfonyl(methyl)amino]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide (PubChem CID 25162948) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[benzenesulfonyl(methyl)amino]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl(methyl)amino]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 25162948 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2-[benzenesulfonyl(methyl)amino]-N-[(2,3-dimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(C=NNC(=O)CN(C)S(=O)(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C18H21N3O5S/c1-21(27(23,24)15-9-5-4-6-10-15)13-17(22)20-19-12-14-8-7-11-16(25-2)18(14)26-3/h4-12H,13H2,1-3H3,(H,20,22) |
| InChIKey | PYPUJNSPBSQHCE-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|