C17H16BrN3O5S — CID 92511372
2-[(Z)-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoic acid (PubChem CID 92511372) has the molecular formula C17H16BrN3O5S and a molecular weight of 454.30 g/mol. Its IUPAC name is 2-[(Z)-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(Z)-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 92511372 |
| Molecular Formula | C17H16BrN3O5S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 2-[(Z)-[[2-[(4-bromophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoic acid |
| SMILES | CN(CC(=O)N/N=C\c1ccccc1C(=O)O)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H16BrN3O5S/c1-21(27(25,26)14-8-6-13(18)7-9-14)11-16(22)20-19-10-12-4-2-3-5-15(12)17(23)24/h2-10H,11H2,1H3,(H,20,22)(H,23,24)/b19-10- |
| InChIKey | UAXCOURPDZCKKE-GRSHGNNSSA-N |
| XLogP | 1.92 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|