C21H26N4O7S — CID 92513080
2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 92513080) has the molecular formula C21H26N4O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92513080 |
| Molecular Formula | C21H26N4O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 2-[(4-acetamidophenyl)sulfonyl-methylamino]-N-[(Z)-(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN(C)S(=O)(=O)c2ccc(NC(C)=O)cc2)c(OC)c1OC |
| InChI | InChI=1S/C21H26N4O7S/c1-14(26)23-16-7-9-17(10-8-16)33(28,29)25(2)13-19(27)24-22-12-15-6-11-18(30-3)21(32-5)20(15)31-4/h6-12H,13H2,1-5H3,(H,23,26)(H,24,27)/b22-12- |
| InChIKey | QFMKHSPTXYZHAJ-UUYOSTAYSA-N |
| XLogP | 1.44 |
| TPSA | 135.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|