C20H22N4O6S — CID 92513082
methyl 4-[(Z)-[[2-[(4-acetamidophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 92513082) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is methyl 4-[(Z)-[[2-[(4-acetamidophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[2-[(4-acetamidophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 92513082 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | methyl 4-[(Z)-[[2-[(4-acetamidophenyl)sulfonyl-methylamino]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)CN(C)S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O6S/c1-14(25)22-17-8-10-18(11-9-17)31(28,29)24(2)13-19(26)23-21-12-15-4-6-16(7-5-15)20(27)30-3/h4-12H,13H2,1-3H3,(H,22,25)(H,23,26)/b21-12- |
| InChIKey | BLYMFABVTQDULR-MTJSOVHGSA-N |
| XLogP | 1.20 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|