C19H22ClN3O4S — CID 5217323
2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(4-ethylphenyl)methylideneamino]acetamide (PubChem CID 5217323) has the molecular formula C19H22ClN3O4S and a molecular weight of 423.92 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(4-ethylphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(4-ethylphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 5217323 |
| Molecular Formula | C19H22ClN3O4S |
| Molecular Weight | 423.92 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonyl-methylamino]-N-[(4-ethylphenyl)methylideneamino]acetamide |
| SMILES | CCc1ccc(C=NNC(=O)CN(C)S(=O)(=O)c2ccc(OC)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22ClN3O4S/c1-4-14-5-7-15(8-6-14)12-21-22-19(24)13-23(2)28(25,26)16-9-10-18(27-3)17(20)11-16/h5-12H,4,13H2,1-3H3,(H,22,24) |
| InChIKey | CZEDEEVLXHEWEG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.92 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|