C23H29N3O7S — CID 100606326
2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]acetamide (PubChem CID 100606326) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]acetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 100606326 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)sulfonyl-methylamino]-N-[(Z)-(3,3-dimethyl-2,4-dihydro-1,5-benzodioxepin-7-yl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)N/N=C\c2ccc3c(c2)OCC(C)(C)CO3)cc1OC |
| InChI | InChI=1S/C23H29N3O7S/c1-23(2)14-32-19-8-6-16(10-21(19)33-15-23)12-24-25-22(27)13-26(3)34(28,29)17-7-9-18(30-4)20(11-17)31-5/h6-12H,13-15H2,1-5H3,(H,25,27)/b24-12- |
| InChIKey | UWNLRBPLTULEJX-MSXFZWOLSA-N |
| XLogP | 2.27 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|