C26H24FN3O9S — CID 126146284
[4-[(Z)-[[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 126146284) has the molecular formula C26H24FN3O9S and a molecular weight of 573.56 g/mol. Its IUPAC name is [4-[(Z)-[[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 126146284 |
| Molecular Formula | C26H24FN3O9S |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | [4-[(Z)-[[2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)cc1OC |
| InChI | InChI=1S/C26H24FN3O9S/c1-35-23-13-17(3-9-22(23)39-26(32)36-2)15-28-29-25(31)16-30(19-6-4-18(27)5-7-19)40(33,34)20-8-10-21-24(14-20)38-12-11-37-21/h3-10,13-15H,11-12,16H2,1-2H3,(H,29,31)/b28-15- |
| InChIKey | PLVWSSWMQQPDLQ-MBTHVWNTSA-N |
| XLogP | 3.10 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|