C26H26FN3O7S — CID 98093193
2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide (PubChem CID 98093193) has the molecular formula C26H26FN3O7S and a molecular weight of 543.57 g/mol. Its IUPAC name is 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide.
| Compound Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 98093193 |
| Molecular Formula | C26H26FN3O7S |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]acetamide |
| SMILES | COc1ccc(/C(C)=N\NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)cc1OC |
| InChI | InChI=1S/C26H26FN3O7S/c1-17(18-4-10-22(34-2)24(14-18)35-3)28-29-26(31)16-30(20-7-5-19(27)6-8-20)38(32,33)21-9-11-23-25(15-21)37-13-12-36-23/h4-11,14-15H,12-13,16H2,1-3H3,(H,29,31)/b28-17- |
| InChIKey | NIGIOHQJOHYYJL-QRQIAZFYSA-N |
| XLogP | 3.35 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|