C24H22FN3O6S — CID 2083601
2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 2083601) has the molecular formula C24H22FN3O6S and a molecular weight of 499.52 g/mol. Its IUPAC name is 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2083601 |
| Molecular Formula | C24H22FN3O6S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]-N-[(4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C=NNC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C24H22FN3O6S/c1-32-20-8-2-17(3-9-20)15-26-27-24(29)16-28(19-6-4-18(25)5-7-19)35(30,31)21-10-11-22-23(14-21)34-13-12-33-22/h2-11,14-15H,12-13,16H2,1H3,(H,27,29) |
| InChIKey | KCEQVKCYLNEYCO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|