C22H19BrFN3O6S — CID 126115560
N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetamide (PubChem CID 126115560) has the molecular formula C22H19BrFN3O6S and a molecular weight of 552.38 g/mol. Its IUPAC name is N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetamide.
| Compound Name | N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetamide |
|---|---|
| PubChem CID | 126115560 |
| Molecular Formula | C22H19BrFN3O6S |
| Molecular Weight | 552.38 g/mol |
| Exact Mass | 551.02 |
| IUPAC Name | N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-[N-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-4-fluoroanilino]acetamide |
| SMILES | Cc1oc(/C=N\NC(=O)CN(c2ccc(F)cc2)S(=O)(=O)c2ccc3c(c2)OCCO3)cc1Br |
| InChI | InChI=1S/C22H19BrFN3O6S/c1-14-19(23)10-17(33-14)12-25-26-22(28)13-27(16-4-2-15(24)3-5-16)34(29,30)18-6-7-20-21(11-18)32-9-8-31-20/h2-7,10-12H,8-9,13H2,1H3,(H,26,28)/b25-12- |
| InChIKey | ABKBIBBTOYLSPH-ROTLSHHCSA-N |
| XLogP | 3.61 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|