C21H18BrCl2N3O4S — CID 98056049
N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 98056049) has the molecular formula C21H18BrCl2N3O4S and a molecular weight of 559.27 g/mol. Its IUPAC name is N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 98056049 |
| Molecular Formula | C21H18BrCl2N3O4S |
| Molecular Weight | 559.27 g/mol |
| Exact Mass | 556.96 |
| IUPAC Name | N-[(Z)-(4-bromo-5-methylfuran-2-yl)methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cc(Br)c(C)o2)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H18BrCl2N3O4S/c1-13-3-5-19(6-4-13)32(29,30)27(17-8-15(23)7-16(24)9-17)12-21(28)26-25-11-18-10-20(22)14(2)31-18/h3-11H,12H2,1-2H3,(H,26,28)/b25-11- |
| InChIKey | HMNGTQGBDLDXQD-GATIEOLUSA-N |
| XLogP | 5.31 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.27 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|