C30H24BrCl4N3O5S — CID 124596870
N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 124596870) has the molecular formula C30H24BrCl4N3O5S and a molecular weight of 760.32 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 124596870 |
| Molecular Formula | C30H24BrCl4N3O5S |
| Molecular Weight | 760.32 g/mol |
| Exact Mass | 756.94 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2cc(Cl)cc(Cl)c2)S(=O)(=O)c2ccc(C)cc2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H24BrCl4N3O5S/c1-18-3-7-25(8-4-18)44(40,41)38(24-12-22(33)11-23(34)13-24)16-29(39)37-36-15-19-9-26(31)30(28(10-19)42-2)43-17-20-5-6-21(32)14-27(20)35/h3-15H,16-17H2,1-2H3,(H,37,39)/b36-15- |
| InChIKey | KRJPEHMLKGMBRF-QEQQSIKZSA-N |
| XLogP | 8.30 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.32 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|