C30H25BrCl3N3O5S — CID 126192171
N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 126192171) has the molecular formula C30H25BrCl3N3O5S and a molecular weight of 725.88 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126192171 |
| Molecular Formula | C30H25BrCl3N3O5S |
| Molecular Weight | 725.88 g/mol |
| Exact Mass | 722.98 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-chloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CN(c2ccc(Cl)cc2)S(=O)(=O)c2ccc(C)cc2)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H25BrCl3N3O5S/c1-19-3-10-24(11-4-19)43(39,40)37(23-8-6-22(32)7-9-23)17-29(38)36-35-16-21-13-25(31)30(28(15-21)41-2)42-18-20-5-12-26(33)27(34)14-20/h3-16H,17-18H2,1-2H3,(H,36,38)/b35-16- |
| InChIKey | SNSGGWWWKFVHKE-NKHVPTTDSA-N |
| XLogP | 7.65 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.88 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|