C30H25Br2Cl2N3O5S — CID 4280994
N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 4280994) has the molecular formula C30H25Br2Cl2N3O5S and a molecular weight of 770.33 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 4280994 |
| Molecular Formula | C30H25Br2Cl2N3O5S |
| Molecular Weight | 770.33 g/mol |
| Exact Mass | 766.93 |
| IUPAC Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-bromo-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | COc1cc(C=NNC(=O)CN(c2ccc(Br)cc2)S(=O)(=O)c2ccc(C)cc2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H25Br2Cl2N3O5S/c1-19-3-11-25(12-4-19)43(39,40)37(24-9-6-22(31)7-10-24)17-29(38)36-35-16-20-13-26(32)30(28(14-20)41-2)42-18-21-5-8-23(33)15-27(21)34/h3-16H,17-18H2,1-2H3,(H,36,38) |
| InChIKey | NKVVOKGXCCXBIA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.33 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|