C32H30BrCl2N3O6S — CID 126190485
N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide (PubChem CID 126190485) has the molecular formula C32H30BrCl2N3O6S and a molecular weight of 735.48 g/mol. Its IUPAC name is N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide.
| Compound Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
|---|---|
| PubChem CID | 126190485 |
| Molecular Formula | C32H30BrCl2N3O6S |
| Molecular Weight | 735.48 g/mol |
| Exact Mass | 733.04 |
| IUPAC Name | N-[(Z)-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(N-(4-ethoxyphenyl)sulfonyl-4-methylanilino)acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C32H30BrCl2N3O6S/c1-4-43-26-11-13-27(14-12-26)45(40,41)38(25-9-5-21(2)6-10-25)19-31(39)37-36-18-22-15-28(33)32(30(16-22)42-3)44-20-23-7-8-24(34)17-29(23)35/h5-18H,4,19-20H2,1-3H3,(H,37,39)/b36-18- |
| InChIKey | FVSOWYQQPRBYNS-VHFSBPNMSA-N |
| XLogP | 7.40 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.48 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|