C31H29BrClN3O6S — CID 5116504
2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide (PubChem CID 5116504) has the molecular formula C31H29BrClN3O6S and a molecular weight of 687.01 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 5116504 |
| Molecular Formula | C31H29BrClN3O6S |
| Molecular Weight | 687.01 g/mol |
| Exact Mass | 685.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-ethoxyanilino]-N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]acetamide |
| SMILES | CCOc1ccccc1N(CC(=O)NN=Cc1cc(Br)c(OCc2ccccc2Cl)c(OC)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H29BrClN3O6S/c1-3-41-28-16-10-9-15-27(28)36(43(38,39)24-12-5-4-6-13-24)20-30(37)35-34-19-22-17-25(32)31(29(18-22)40-2)42-21-23-11-7-8-14-26(23)33/h4-19H,3,20-21H2,1-2H3,(H,35,37) |
| InChIKey | BVYHOSWVUFCONV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.01 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|