C30H23Cl2N3O3S — CID 98061924
N-[(Z)-anthracen-9-ylmethylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 98061924) has the molecular formula C30H23Cl2N3O3S and a molecular weight of 576.51 g/mol. Its IUPAC name is N-[(Z)-anthracen-9-ylmethylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-anthracen-9-ylmethylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 98061924 |
| Molecular Formula | C30H23Cl2N3O3S |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 575.08 |
| IUPAC Name | N-[(Z)-anthracen-9-ylmethylideneamino]-2-(3,5-dichloro-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2c3ccccc3cc3ccccc23)c2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C30H23Cl2N3O3S/c1-20-10-12-26(13-11-20)39(37,38)35(25-16-23(31)15-24(32)17-25)19-30(36)34-33-18-29-27-8-4-2-6-21(27)14-22-7-3-5-9-28(22)29/h2-18H,19H2,1H3,(H,34,36)/b33-18- |
| InChIKey | SXMSDRRWZKBPHX-OHUYPAJKSA-N |
| XLogP | 6.95 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|