C36H28ClN3O3S — CID 43878954
N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 43878954) has the molecular formula C36H28ClN3O3S and a molecular weight of 618.16 g/mol. Its IUPAC name is N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 43878954 |
| Molecular Formula | C36H28ClN3O3S |
| Molecular Weight | 618.16 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | N-[(E)-anthracen-9-ylmethylideneamino]-2-[(4-chlorophenyl)methyl-(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2ccc(Cl)cc2)c2ccccc2C(=O)N/N=C/c2c3ccccc3cc3ccccc23)cc1 |
| InChI | InChI=1S/C36H28ClN3O3S/c1-25-14-20-30(21-15-25)44(42,43)40(24-26-16-18-29(37)19-17-26)35-13-7-6-12-33(35)36(41)39-38-23-34-31-10-4-2-8-27(31)22-28-9-3-5-11-32(28)34/h2-23H,24H2,1H3,(H,39,41)/b38-23+ |
| InChIKey | CKPLLUGPSLQSOQ-FNTLCPBMSA-N |
| XLogP | 8.11 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.16 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|