C30H21ClF3N3O3S — CID 3829929
N-(anthracen-9-ylmethylideneamino)-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide (PubChem CID 3829929) has the molecular formula C30H21ClF3N3O3S and a molecular weight of 596.03 g/mol. Its IUPAC name is N-(anthracen-9-ylmethylideneamino)-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(anthracen-9-ylmethylideneamino)-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 3829929 |
| Molecular Formula | C30H21ClF3N3O3S |
| Molecular Weight | 596.03 g/mol |
| Exact Mass | 595.09 |
| IUPAC Name | N-(anthracen-9-ylmethylideneamino)-2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NN=Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C30H21ClF3N3O3S/c31-28-15-14-22(17-27(28)30(32,33)34)37(41(39,40)23-10-2-1-3-11-23)19-29(38)36-35-18-26-24-12-6-4-8-20(24)16-21-9-5-7-13-25(21)26/h1-18H,19H2,(H,36,38) |
| InChIKey | OMEWHQJZBNRZIO-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.03 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|