C23H17ClF3N3O5S — CID 6078694
2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]acetamide (PubChem CID 6078694) has the molecular formula C23H17ClF3N3O5S and a molecular weight of 539.92 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 6078694 |
| Molecular Formula | C23H17ClF3N3O5S |
| Molecular Weight | 539.92 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)N/N=C\c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H17ClF3N3O5S/c24-19-8-7-16(11-18(19)23(25,26)27)30(36(32,33)17-4-2-1-3-5-17)13-22(31)29-28-12-15-6-9-20-21(10-15)35-14-34-20/h1-12H,13-14H2,(H,29,31)/b28-12- |
| InChIKey | WYJNKWNQJDMMMJ-NVJOKUIPSA-N |
| XLogP | 4.43 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.92 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|