C25H21ClF3N3O4S2 — CID 3714300
2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 3714300) has the molecular formula C25H21ClF3N3O4S2 and a molecular weight of 584.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 3714300 |
| Molecular Formula | C25H21ClF3N3O4S2 |
| Molecular Weight | 584.04 g/mol |
| Exact Mass | 583.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]-N-[[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)NN=Cc1cccc(OC2CSC2)c1 |
| InChI | InChI=1S/C25H21ClF3N3O4S2/c26-23-10-9-18(12-22(23)25(27,28)29)32(38(34,35)21-7-2-1-3-8-21)14-24(33)31-30-13-17-5-4-6-19(11-17)36-20-15-37-16-20/h1-13,20H,14-16H2,(H,31,33) |
| InChIKey | GACZQGWYSAMIGW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.04 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|