C24H22ClN3O4S2 — CID 6883503
2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(E)-[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 6883503) has the molecular formula C24H22ClN3O4S2 and a molecular weight of 516.04 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(E)-[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(E)-[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6883503 |
| Molecular Formula | C24H22ClN3O4S2 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(E)-[4-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN(c1cccc(Cl)c1)S(=O)(=O)c1ccccc1)N/N=C/c1ccc(OC2CSC2)cc1 |
| InChI | InChI=1S/C24H22ClN3O4S2/c25-19-5-4-6-20(13-19)28(34(30,31)23-7-2-1-3-8-23)15-24(29)27-26-14-18-9-11-21(12-10-18)32-22-16-33-17-22/h1-14,22H,15-17H2,(H,27,29)/b26-14+ |
| InChIKey | OKFCHLMLSWVCNQ-VULFUBBASA-N |
| XLogP | 4.18 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|