C29H21ClF3N3O5S — CID 98107956
[4-[(Z)-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 98107956) has the molecular formula C29H21ClF3N3O5S and a molecular weight of 616.02 g/mol. Its IUPAC name is [4-[(Z)-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 98107956 |
| Molecular Formula | C29H21ClF3N3O5S |
| Molecular Weight | 616.02 g/mol |
| Exact Mass | 615.08 |
| IUPAC Name | [4-[(Z)-[[2-[N-(benzenesulfonyl)-4-chloro-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | O=C(CN(c1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccccc1)N/N=C\c1ccc(OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21ClF3N3O5S/c30-26-16-13-22(17-25(26)29(31,32)33)36(42(39,40)24-9-5-2-6-10-24)19-27(37)35-34-18-20-11-14-23(15-12-20)41-28(38)21-7-3-1-4-8-21/h1-18H,19H2,(H,35,37)/b34-18- |
| InChIKey | WXBGFBRWGGSOLO-HQDYHJHZSA-N |
| XLogP | 5.92 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.02 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|