C29H33Cl2N3O4S — CID 21212109
2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(4-octoxyphenyl)methylideneamino]acetamide (PubChem CID 21212109) has the molecular formula C29H33Cl2N3O4S and a molecular weight of 590.57 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(4-octoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(4-octoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 21212109 |
| Molecular Formula | C29H33Cl2N3O4S |
| Molecular Weight | 590.57 g/mol |
| Exact Mass | 589.16 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[(E)-(4-octoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCCCCOc1ccc(/C=N/NC(=O)CN(c2ccc(Cl)c(Cl)c2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H33Cl2N3O4S/c1-2-3-4-5-6-10-19-38-25-16-13-23(14-17-25)21-32-33-29(35)22-34(24-15-18-27(30)28(31)20-24)39(36,37)26-11-8-7-9-12-26/h7-9,11-18,20-21H,2-6,10,19,22H2,1H3,(H,33,35)/b32-21+ |
| InChIKey | SCGDHLYIWOVJKL-RUMWWMSVSA-N |
| XLogP | 7.08 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.57 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|