C26H23ClF3N3O7S — CID 124534944
[4-[(Z)-[[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 124534944) has the molecular formula C26H23ClF3N3O7S and a molecular weight of 614.00 g/mol. Its IUPAC name is [4-[(Z)-[[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 124534944 |
| Molecular Formula | C26H23ClF3N3O7S |
| Molecular Weight | 614.00 g/mol |
| Exact Mass | 613.09 |
| IUPAC Name | [4-[(Z)-[[2-[4-chloro-N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)CN(c2ccc(Cl)c(C(F)(F)F)c2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C26H23ClF3N3O7S/c1-16-4-8-19(9-5-16)41(36,37)33(18-7-10-21(27)20(13-18)26(28,29)30)15-24(34)32-31-14-17-6-11-22(23(12-17)38-2)40-25(35)39-3/h4-14H,15H2,1-3H3,(H,32,34)/b31-14- |
| InChIKey | WSONCCGJIQYGBQ-AQLQTECXSA-N |
| XLogP | 5.17 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.00 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|