C29H29N5O5S2 — CID 124544400
2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide (PubChem CID 124544400) has the molecular formula C29H29N5O5S2 and a molecular weight of 591.72 g/mol. Its IUPAC name is 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124544400 |
| Molecular Formula | C29H29N5O5S2 |
| Molecular Weight | 591.72 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | 2-[benzenesulfonyl-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-N-[(Z)-[3-(thietan-3-yloxy)phenyl]methylideneamino]acetamide |
| SMILES | Cc1c(N(CC(=O)N/N=C\c2cccc(OC3CSC3)c2)S(=O)(=O)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C29H29N5O5S2/c1-21-28(29(36)34(32(21)2)23-11-5-3-6-12-23)33(41(37,38)26-14-7-4-8-15-26)18-27(35)31-30-17-22-10-9-13-24(16-22)39-25-19-40-20-25/h3-17,25H,18-20H2,1-2H3,(H,31,35)/b30-17- |
| InChIKey | HOTHUWKEWALODY-LQNQUEJISA-N |
| XLogP | 3.32 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.72 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|